C14H10F4N2OS — CID 2824729
N-(4-fluorophenyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide (PubChem CID 2824729) has the molecular formula C14H10F4N2OS and a molecular weight of 330.31 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 2824729 |
| Molecular Formula | C14H10F4N2OS |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | N-(4-fluorophenyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide |
| SMILES | O=C(CSc1ccc(C(F)(F)F)cn1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C14H10F4N2OS/c15-10-2-4-11(5-3-10)20-12(21)8-22-13-6-1-9(7-19-13)14(16,17)18/h1-7H,8H2,(H,20,21) |
| InChIKey | YLIVNGWZDYQKEV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |