C16H13F3N2O3S — CID 51182392
(4-acetamidophenyl) 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetate (PubChem CID 51182392) has the molecular formula C16H13F3N2O3S and a molecular weight of 370.35 g/mol. Its IUPAC name is (4-acetamidophenyl) 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetate.
| Compound Name | (4-acetamidophenyl) 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetate |
|---|---|
| PubChem CID | 51182392 |
| Molecular Formula | C16H13F3N2O3S |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | (4-acetamidophenyl) 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetate |
| SMILES | CC(=O)Nc1ccc(OC(=O)CSc2ccc(C(F)(F)F)cn2)cc1 |
| InChI | InChI=1S/C16H13F3N2O3S/c1-10(22)21-12-3-5-13(6-4-12)24-15(23)9-25-14-7-2-11(8-20-14)16(17,18)19/h2-8H,9H2,1H3,(H,21,22) |
| InChIKey | WAMVEGNMVXMUSK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|