C18H13F3N2O3S — CID 46813124
N-[2-oxo-4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]chromen-7-yl]acetamide (PubChem CID 46813124) has the molecular formula C18H13F3N2O3S and a molecular weight of 394.37 g/mol. Its IUPAC name is N-[2-oxo-4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]chromen-7-yl]acetamide.
| Compound Name | N-[2-oxo-4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]chromen-7-yl]acetamide |
|---|---|
| PubChem CID | 46813124 |
| Molecular Formula | C18H13F3N2O3S |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | N-[2-oxo-4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]chromen-7-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c(CSc3ccc(C(F)(F)F)cn3)cc(=O)oc2c1 |
| InChI | InChI=1S/C18H13F3N2O3S/c1-10(24)23-13-3-4-14-11(6-17(25)26-15(14)7-13)9-27-16-5-2-12(8-22-16)18(19,20)21/h2-8H,9H2,1H3,(H,23,24) |
| InChIKey | JVMDPOKSJVMEOV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|