C15H12F3N5O3S — CID 16534016
N-[4-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-2-oxochromen-7-yl]acetamide (PubChem CID 16534016) has the molecular formula C15H12F3N5O3S and a molecular weight of 399.35 g/mol. Its IUPAC name is N-[4-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-2-oxochromen-7-yl]acetamide.
| Compound Name | N-[4-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-2-oxochromen-7-yl]acetamide |
|---|---|
| PubChem CID | 16534016 |
| Molecular Formula | C15H12F3N5O3S |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | N-[4-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-2-oxochromen-7-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c(CSc3nnc(C(F)(F)F)n3N)cc(=O)oc2c1 |
| InChI | InChI=1S/C15H12F3N5O3S/c1-7(24)20-9-2-3-10-8(4-12(25)26-11(10)5-9)6-27-14-22-21-13(23(14)19)15(16,17)18/h2-5H,6,19H2,1H3,(H,20,24) |
| InChIKey | NSBHRODKOTYQTJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 116.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|