C17H11F3N4O2S — CID 9103245
1-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]benzo[f]chromen-3-one (PubChem CID 9103245) has the molecular formula C17H11F3N4O2S and a molecular weight of 392.36 g/mol. Its IUPAC name is 1-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]benzo[f]chromen-3-one.
| Compound Name | 1-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 9103245 |
| Molecular Formula | C17H11F3N4O2S |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 1-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]benzo[f]chromen-3-one |
| SMILES | Nn1c(SCc2cc(=O)oc3ccc4ccccc4c23)nnc1C(F)(F)F |
| InChI | InChI=1S/C17H11F3N4O2S/c18-17(19,20)15-22-23-16(24(15)21)27-8-10-7-13(25)26-12-6-5-9-3-1-2-4-11(9)14(10)12/h1-7H,8,21H2 |
| InChIKey | YAPONHWYCROXMP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|