C22H14Cl2N4O2S — CID 3944868
1-[[4-amino-5-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]benzo[f]chromen-3-one (PubChem CID 3944868) has the molecular formula C22H14Cl2N4O2S and a molecular weight of 469.35 g/mol. Its IUPAC name is 1-[[4-amino-5-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]benzo[f]chromen-3-one.
| Compound Name | 1-[[4-amino-5-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 3944868 |
| Molecular Formula | C22H14Cl2N4O2S |
| Molecular Weight | 469.35 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | 1-[[4-amino-5-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]benzo[f]chromen-3-one |
| SMILES | Nn1c(SCc2cc(=O)oc3ccc4ccccc4c23)nnc1-c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C22H14Cl2N4O2S/c23-14-6-7-17(24)16(10-14)21-26-27-22(28(21)25)31-11-13-9-19(29)30-18-8-5-12-3-1-2-4-15(12)20(13)18/h1-10H,11,25H2 |
| InChIKey | QTDXMXHIBGKXPR-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.35 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|