C24H14ClN3O4S2 — CID 164614722
1-[[5-[(5-chloro-1,3-benzoxazol-2-yl)sulfanylmethyl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]benzo[f]chromen-3-one (PubChem CID 164614722) has the molecular formula C24H14ClN3O4S2 and a molecular weight of 507.98 g/mol. Its IUPAC name is 1-[[5-[(5-chloro-1,3-benzoxazol-2-yl)sulfanylmethyl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]benzo[f]chromen-3-one.
| Compound Name | 1-[[5-[(5-chloro-1,3-benzoxazol-2-yl)sulfanylmethyl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 164614722 |
| Molecular Formula | C24H14ClN3O4S2 |
| Molecular Weight | 507.98 g/mol |
| Exact Mass | 507.01 |
| IUPAC Name | 1-[[5-[(5-chloro-1,3-benzoxazol-2-yl)sulfanylmethyl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]benzo[f]chromen-3-one |
| SMILES | O=c1cc(CSc2nnc(CSc3nc4cc(Cl)ccc4o3)o2)c2c(ccc3ccccc32)o1 |
| InChI | InChI=1S/C24H14ClN3O4S2/c25-15-6-8-18-17(10-15)26-23(31-18)34-12-20-27-28-24(32-20)33-11-14-9-21(29)30-19-7-5-13-3-1-2-4-16(13)22(14)19/h1-10H,11-12H2 |
| InChIKey | LGDLYVZMFKFEDK-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.98 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|