C24H16N4O3S — CID 166450510
1-[[4-(1,3-benzoxazol-2-ylsulfanylmethyl)triazol-1-yl]methyl]benzo[f]chromen-3-one (PubChem CID 166450510) has the molecular formula C24H16N4O3S and a molecular weight of 440.48 g/mol. Its IUPAC name is 1-[[4-(1,3-benzoxazol-2-ylsulfanylmethyl)triazol-1-yl]methyl]benzo[f]chromen-3-one.
| Compound Name | 1-[[4-(1,3-benzoxazol-2-ylsulfanylmethyl)triazol-1-yl]methyl]benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 166450510 |
| Molecular Formula | C24H16N4O3S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 1-[[4-(1,3-benzoxazol-2-ylsulfanylmethyl)triazol-1-yl]methyl]benzo[f]chromen-3-one |
| SMILES | O=c1cc(Cn2cc(CSc3nc4ccccc4o3)nn2)c2c(ccc3ccccc32)o1 |
| InChI | InChI=1S/C24H16N4O3S/c29-22-11-16(23-18-6-2-1-5-15(18)9-10-21(23)30-22)12-28-13-17(26-27-28)14-32-24-25-19-7-3-4-8-20(19)31-24/h1-11,13H,12,14H2 |
| InChIKey | FAKMGQGXWVDQLA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 86.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|