C23H17N3O2S — CID 2633354
1-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzo[f]chromen-3-one (PubChem CID 2633354) has the molecular formula C23H17N3O2S and a molecular weight of 399.48 g/mol. Its IUPAC name is 1-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzo[f]chromen-3-one.
| Compound Name | 1-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 2633354 |
| Molecular Formula | C23H17N3O2S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 1-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzo[f]chromen-3-one |
| SMILES | Cn1c(SCc2cc(=O)oc3ccc4ccccc4c23)nnc1-c1ccccc1 |
| InChI | InChI=1S/C23H17N3O2S/c1-26-22(16-8-3-2-4-9-16)24-25-23(26)29-14-17-13-20(27)28-19-12-11-15-7-5-6-10-18(15)21(17)19/h2-13H,14H2,1H3 |
| InChIKey | SGYCIILIGOWTHO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|