C21H19N3O2S — CID 2108409
7-methyl-4-[[4-methyl-5-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]chromen-2-one (PubChem CID 2108409) has the molecular formula C21H19N3O2S and a molecular weight of 377.47 g/mol. Its IUPAC name is 7-methyl-4-[[4-methyl-5-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]chromen-2-one.
| Compound Name | 7-methyl-4-[[4-methyl-5-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]chromen-2-one |
|---|---|
| PubChem CID | 2108409 |
| Molecular Formula | C21H19N3O2S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 7-methyl-4-[[4-methyl-5-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]chromen-2-one |
| SMILES | Cc1ccc2c(CSc3nnc(-c4ccccc4C)n3C)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H19N3O2S/c1-13-8-9-17-15(11-19(25)26-18(17)10-13)12-27-21-23-22-20(24(21)3)16-7-5-4-6-14(16)2/h4-11H,12H2,1-3H3 |
| InChIKey | OHMMEOKFUNFXMR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|