C25H20ClN3O3S — CID 3973528
1-[[5-(4-chlorophenyl)-4-(2-methoxyethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]benzo[f]chromen-3-one (PubChem CID 3973528) has the molecular formula C25H20ClN3O3S and a molecular weight of 477.97 g/mol. Its IUPAC name is 1-[[5-(4-chlorophenyl)-4-(2-methoxyethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]benzo[f]chromen-3-one.
| Compound Name | 1-[[5-(4-chlorophenyl)-4-(2-methoxyethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 3973528 |
| Molecular Formula | C25H20ClN3O3S |
| Molecular Weight | 477.97 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 1-[[5-(4-chlorophenyl)-4-(2-methoxyethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]benzo[f]chromen-3-one |
| SMILES | COCCn1c(SCc2cc(=O)oc3ccc4ccccc4c23)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H20ClN3O3S/c1-31-13-12-29-24(17-6-9-19(26)10-7-17)27-28-25(29)33-15-18-14-22(30)32-21-11-8-16-4-2-3-5-20(16)23(18)21/h2-11,14H,12-13,15H2,1H3 |
| InChIKey | XKFLKULOCSYXHT-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.97 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|