C23H22ClN3O3S — CID 5108141
4-[[5-(4-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-methylchromen-2-one (PubChem CID 5108141) has the molecular formula C23H22ClN3O3S and a molecular weight of 455.97 g/mol. Its IUPAC name is 4-[[5-(4-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-methylchromen-2-one.
| Compound Name | 4-[[5-(4-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-methylchromen-2-one |
|---|---|
| PubChem CID | 5108141 |
| Molecular Formula | C23H22ClN3O3S |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 4-[[5-(4-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-methylchromen-2-one |
| SMILES | COCCCn1c(SCc2cc(=O)oc3cc(C)ccc23)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H22ClN3O3S/c1-15-4-9-19-17(13-21(28)30-20(19)12-15)14-31-23-26-25-22(27(23)10-3-11-29-2)16-5-7-18(24)8-6-16/h4-9,12-13H,3,10-11,14H2,1-2H3 |
| InChIKey | QUXWVXMMUBFQMC-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|