C21H17Cl2N3O2S — CID 16505702
6-chloro-4-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanylmethyl]-7-methylchromen-2-one (PubChem CID 16505702) has the molecular formula C21H17Cl2N3O2S and a molecular weight of 446.36 g/mol. Its IUPAC name is 6-chloro-4-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanylmethyl]-7-methylchromen-2-one.
| Compound Name | 6-chloro-4-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanylmethyl]-7-methylchromen-2-one |
|---|---|
| PubChem CID | 16505702 |
| Molecular Formula | C21H17Cl2N3O2S |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | 6-chloro-4-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanylmethyl]-7-methylchromen-2-one |
| SMILES | CCn1c(SCc2cc(=O)oc3cc(C)c(Cl)cc23)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H17Cl2N3O2S/c1-3-26-20(13-4-6-15(22)7-5-13)24-25-21(26)29-11-14-9-19(27)28-18-8-12(2)17(23)10-16(14)18/h4-10H,3,11H2,1-2H3 |
| InChIKey | IYEMJQUJMDNCDN-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|