C18H14ClN3O3S — CID 7816366
6-chloro-4-[[5-(furan-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-7-methylchromen-2-one (PubChem CID 7816366) has the molecular formula C18H14ClN3O3S and a molecular weight of 387.85 g/mol. Its IUPAC name is 6-chloro-4-[[5-(furan-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-7-methylchromen-2-one.
| Compound Name | 6-chloro-4-[[5-(furan-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-7-methylchromen-2-one |
|---|---|
| PubChem CID | 7816366 |
| Molecular Formula | C18H14ClN3O3S |
| Molecular Weight | 387.85 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 6-chloro-4-[[5-(furan-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-7-methylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CSc3nnc(-c4ccco4)n3C)c2cc1Cl |
| InChI | InChI=1S/C18H14ClN3O3S/c1-10-6-15-12(8-13(10)19)11(7-16(23)25-15)9-26-18-21-20-17(22(18)2)14-4-3-5-24-14/h3-8H,9H2,1-2H3 |
| InChIKey | MDQYWDYCEUMGAB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.85 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|