C18H13ClN4O2S — CID 7465426
6-chloro-7-methyl-4-[(1-phenyltetrazol-5-yl)sulfanylmethyl]chromen-2-one (PubChem CID 7465426) has the molecular formula C18H13ClN4O2S and a molecular weight of 384.85 g/mol. Its IUPAC name is 6-chloro-7-methyl-4-[(1-phenyltetrazol-5-yl)sulfanylmethyl]chromen-2-one.
| Compound Name | 6-chloro-7-methyl-4-[(1-phenyltetrazol-5-yl)sulfanylmethyl]chromen-2-one |
|---|---|
| PubChem CID | 7465426 |
| Molecular Formula | C18H13ClN4O2S |
| Molecular Weight | 384.85 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 6-chloro-7-methyl-4-[(1-phenyltetrazol-5-yl)sulfanylmethyl]chromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CSc3nnnn3-c3ccccc3)c2cc1Cl |
| InChI | InChI=1S/C18H13ClN4O2S/c1-11-7-16-14(9-15(11)19)12(8-17(24)25-16)10-26-18-20-21-22-23(18)13-5-3-2-4-6-13/h2-9H,10H2,1H3 |
| InChIKey | PDUYMLDKLCWJCB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.85 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|