C19H16N4O3S — CID 8916701
4-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]-7-hydroxychromen-2-one (PubChem CID 8916701) has the molecular formula C19H16N4O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is 4-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]-7-hydroxychromen-2-one.
| Compound Name | 4-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]-7-hydroxychromen-2-one |
|---|---|
| PubChem CID | 8916701 |
| Molecular Formula | C19H16N4O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 4-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]-7-hydroxychromen-2-one |
| SMILES | Cc1cccc(C)c1-n1nnnc1SCc1cc(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C19H16N4O3S/c1-11-4-3-5-12(2)18(11)23-19(20-21-22-23)27-10-13-8-17(25)26-16-9-14(24)6-7-15(13)16/h3-9,24H,10H2,1-2H3 |
| InChIKey | IFFAPMYFWLCUEN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|