C18H14N4O3S — CID 9407736
7-hydroxy-4-[[1-(4-methylphenyl)tetrazol-5-yl]sulfanylmethyl]chromen-2-one (PubChem CID 9407736) has the molecular formula C18H14N4O3S and a molecular weight of 366.40 g/mol. Its IUPAC name is 7-hydroxy-4-[[1-(4-methylphenyl)tetrazol-5-yl]sulfanylmethyl]chromen-2-one.
| Compound Name | 7-hydroxy-4-[[1-(4-methylphenyl)tetrazol-5-yl]sulfanylmethyl]chromen-2-one |
|---|---|
| PubChem CID | 9407736 |
| Molecular Formula | C18H14N4O3S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 7-hydroxy-4-[[1-(4-methylphenyl)tetrazol-5-yl]sulfanylmethyl]chromen-2-one |
| SMILES | Cc1ccc(-n2nnnc2SCc2cc(=O)oc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C18H14N4O3S/c1-11-2-4-13(5-3-11)22-18(19-20-21-22)26-10-12-8-17(24)25-16-9-14(23)6-7-15(12)16/h2-9,23H,10H2,1H3 |
| InChIKey | DDEXZILZRGVLHC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|