C20H18N4O3S — CID 9407845
6-ethyl-7-hydroxy-4-[[1-(4-methylphenyl)tetrazol-5-yl]sulfanylmethyl]chromen-2-one (PubChem CID 9407845) has the molecular formula C20H18N4O3S and a molecular weight of 394.46 g/mol. Its IUPAC name is 6-ethyl-7-hydroxy-4-[[1-(4-methylphenyl)tetrazol-5-yl]sulfanylmethyl]chromen-2-one.
| Compound Name | 6-ethyl-7-hydroxy-4-[[1-(4-methylphenyl)tetrazol-5-yl]sulfanylmethyl]chromen-2-one |
|---|---|
| PubChem CID | 9407845 |
| Molecular Formula | C20H18N4O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 6-ethyl-7-hydroxy-4-[[1-(4-methylphenyl)tetrazol-5-yl]sulfanylmethyl]chromen-2-one |
| SMILES | CCc1cc2c(CSc3nnnn3-c3ccc(C)cc3)cc(=O)oc2cc1O |
| InChI | InChI=1S/C20H18N4O3S/c1-3-13-8-16-14(9-19(26)27-18(16)10-17(13)25)11-28-20-21-22-23-24(20)15-6-4-12(2)5-7-15/h4-10,25H,3,11H2,1-2H3 |
| InChIKey | CESIROLPCFWGPC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|