C23H18N4O2S — CID 7661528
1-[[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]benzo[f]chromen-3-one (PubChem CID 7661528) has the molecular formula C23H18N4O2S and a molecular weight of 414.49 g/mol. Its IUPAC name is 1-[[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]benzo[f]chromen-3-one.
| Compound Name | 1-[[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 7661528 |
| Molecular Formula | C23H18N4O2S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 1-[[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]benzo[f]chromen-3-one |
| SMILES | Cc1ccc(-n2nnnc2SCc2cc(=O)oc3ccc4ccccc4c23)cc1C |
| InChI | InChI=1S/C23H18N4O2S/c1-14-7-9-18(11-15(14)2)27-23(24-25-26-27)30-13-17-12-21(28)29-20-10-8-16-5-3-4-6-19(16)22(17)20/h3-12H,13H2,1-2H3 |
| InChIKey | MVZDWVRXOWDZIE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|