C23H18N4O3S — CID 2632371
1-[[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanylmethyl]benzo[f]chromen-3-one (PubChem CID 2632371) has the molecular formula C23H18N4O3S and a molecular weight of 430.49 g/mol. Its IUPAC name is 1-[[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanylmethyl]benzo[f]chromen-3-one.
| Compound Name | 1-[[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanylmethyl]benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 2632371 |
| Molecular Formula | C23H18N4O3S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 1-[[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanylmethyl]benzo[f]chromen-3-one |
| SMILES | COc1ccc(C)cc1-n1nnnc1SCc1cc(=O)oc2ccc3ccccc3c12 |
| InChI | InChI=1S/C23H18N4O3S/c1-14-7-9-19(29-2)18(11-14)27-23(24-25-26-27)31-13-16-12-21(28)30-20-10-8-15-5-3-4-6-17(15)22(16)20/h3-12H,13H2,1-2H3 |
| InChIKey | CAGJOWUTJNUDOQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|