C19H16O5S — CID 7675933
(7-hydroxy-2-oxochromen-4-yl)methyl 2-(4-methylphenyl)sulfanylacetate (PubChem CID 7675933) has the molecular formula C19H16O5S and a molecular weight of 356.40 g/mol. Its IUPAC name is (7-hydroxy-2-oxochromen-4-yl)methyl 2-(4-methylphenyl)sulfanylacetate.
| Compound Name | (7-hydroxy-2-oxochromen-4-yl)methyl 2-(4-methylphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 7675933 |
| Molecular Formula | C19H16O5S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | (7-hydroxy-2-oxochromen-4-yl)methyl 2-(4-methylphenyl)sulfanylacetate |
| SMILES | Cc1ccc(SCC(=O)OCc2cc(=O)oc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C19H16O5S/c1-12-2-5-15(6-3-12)25-11-19(22)23-10-13-8-18(21)24-17-9-14(20)4-7-16(13)17/h2-9,20H,10-11H2,1H3 |
| InChIKey | SSRVTAKVVWZRRM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|