C20H18O6 — CID 7981980
(7-hydroxy-2-oxochromen-4-yl)methyl 2-(2,3-dimethylphenoxy)acetate (PubChem CID 7981980) has the molecular formula C20H18O6 and a molecular weight of 354.36 g/mol. Its IUPAC name is (7-hydroxy-2-oxochromen-4-yl)methyl 2-(2,3-dimethylphenoxy)acetate.
| Compound Name | (7-hydroxy-2-oxochromen-4-yl)methyl 2-(2,3-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 7981980 |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | (7-hydroxy-2-oxochromen-4-yl)methyl 2-(2,3-dimethylphenoxy)acetate |
| SMILES | Cc1cccc(OCC(=O)OCc2cc(=O)oc3cc(O)ccc23)c1C |
| InChI | InChI=1S/C20H18O6/c1-12-4-3-5-17(13(12)2)24-11-20(23)25-10-14-8-19(22)26-18-9-15(21)6-7-16(14)18/h3-9,21H,10-11H2,1-2H3 |
| InChIKey | WRUCDIZPMOFLBD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|