C20H17FO5 — CID 8914762
(6,7-dimethyl-2-oxochromen-4-yl)methyl 2-(3-fluorophenoxy)acetate (PubChem CID 8914762) has the molecular formula C20H17FO5 and a molecular weight of 356.35 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-(3-fluorophenoxy)acetate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-(3-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 8914762 |
| Molecular Formula | C20H17FO5 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-(3-fluorophenoxy)acetate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)COc3cccc(F)c3)c2cc1C |
| InChI | InChI=1S/C20H17FO5/c1-12-6-17-14(8-19(22)26-18(17)7-13(12)2)10-25-20(23)11-24-16-5-3-4-15(21)9-16/h3-9H,10-11H2,1-2H3 |
| InChIKey | WDXVOJGUGJXBGB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|