C19H14F2O4 — CID 7764002
(6,7-dimethyl-2-oxochromen-4-yl)methyl 2,4-difluorobenzoate (PubChem CID 7764002) has the molecular formula C19H14F2O4 and a molecular weight of 344.31 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl 2,4-difluorobenzoate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 2,4-difluorobenzoate |
|---|---|
| PubChem CID | 7764002 |
| Molecular Formula | C19H14F2O4 |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 2,4-difluorobenzoate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)c3ccc(F)cc3F)c2cc1C |
| InChI | InChI=1S/C19H14F2O4/c1-10-5-15-12(7-18(22)25-17(15)6-11(10)2)9-24-19(23)14-4-3-13(20)8-16(14)21/h3-8H,9H2,1-2H3 |
| InChIKey | QABHYDBBFCRHEZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|