C17H13BrO5 — CID 8014150
(6,7-dimethyl-2-oxochromen-4-yl)methyl 5-bromofuran-2-carboxylate (PubChem CID 8014150) has the molecular formula C17H13BrO5 and a molecular weight of 377.19 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl 5-bromofuran-2-carboxylate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 5-bromofuran-2-carboxylate |
|---|---|
| PubChem CID | 8014150 |
| Molecular Formula | C17H13BrO5 |
| Molecular Weight | 377.19 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 5-bromofuran-2-carboxylate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)c3ccc(Br)o3)c2cc1C |
| InChI | InChI=1S/C17H13BrO5/c1-9-5-12-11(7-16(19)23-14(12)6-10(9)2)8-21-17(20)13-3-4-15(18)22-13/h3-7H,8H2,1-2H3 |
| InChIKey | AVXDOOTYKHAEHN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.19 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|