C22H22O4 — CID 8527160
(6,7-dimethyl-2-oxochromen-4-yl)methyl 2-(3,4-dimethylphenyl)acetate (PubChem CID 8527160) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-(3,4-dimethylphenyl)acetate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-(3,4-dimethylphenyl)acetate |
|---|---|
| PubChem CID | 8527160 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-(3,4-dimethylphenyl)acetate |
| SMILES | Cc1ccc(CC(=O)OCc2cc(=O)oc3cc(C)c(C)cc23)cc1C |
| InChI | InChI=1S/C22H22O4/c1-13-5-6-17(7-14(13)2)10-21(23)25-12-18-11-22(24)26-20-9-16(4)15(3)8-19(18)20/h5-9,11H,10,12H2,1-4H3 |
| InChIKey | DVWCWTXXQDSUCM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|