C19H19N3O4 — CID 46602836
(6,7-dimethyl-2-oxochromen-4-yl)methyl 2-[methyl(pyrimidin-2-yl)amino]acetate (PubChem CID 46602836) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-[methyl(pyrimidin-2-yl)amino]acetate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-[methyl(pyrimidin-2-yl)amino]acetate |
|---|---|
| PubChem CID | 46602836 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-[methyl(pyrimidin-2-yl)amino]acetate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)CN(C)c3ncccn3)c2cc1C |
| InChI | InChI=1S/C19H19N3O4/c1-12-7-15-14(9-17(23)26-16(15)8-13(12)2)11-25-18(24)10-22(3)19-20-5-4-6-21-19/h4-9H,10-11H2,1-3H3 |
| InChIKey | DQQJFDNYGQEQRH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|