(6,7-dimethyl-2-oxochromen-4-yl)methyl 2-fluorobenzoate

C19H15FO4 — CID 7864171

IUPAC(6,7-dimethyl-2-oxochromen-4-yl)methyl 2-fluorobenzoate
SMILESCc1cc2oc(=O)cc(COC(=O)c3ccccc3F)c2cc1C
InChIInChI=1S/C19H15FO4/c1-11-7-15-13(9-18(21)24-17(15)8-12(11)2)10-23-19(22)14-5-3-4-6-16(14)20/h3-9H,10H2,1-2H3
InChIKeyHGQDPRKNLFMGDT-UHFFFAOYSA-N
MW326.32 g/mol
LogP3.91
Rot. Bonds3

About (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-fluorobenzoate

(6,7-dimethyl-2-oxochromen-4-yl)methyl 2-fluorobenzoate (PubChem CID 7864171) has the molecular formula C19H15FO4 and a molecular weight of 326.32 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-fluorobenzoate.

Molecular Properties

Compound Name(6,7-dimethyl-2-oxochromen-4-yl)methyl 2-fluorobenzoate
PubChem CID7864171
Molecular FormulaC19H15FO4
Molecular Weight326.32 g/mol
Exact Mass326.10
IUPAC Name(6,7-dimethyl-2-oxochromen-4-yl)methyl 2-fluorobenzoate
SMILESCc1cc2oc(=O)cc(COC(=O)c3ccccc3F)c2cc1C
InChIInChI=1S/C19H15FO4/c1-11-7-15-13(9-18(21)24-17(15)8-12(11)2)10-23-19(22)14-5-3-4-6-16(14)20/h3-9H,10H2,1-2H3
InChIKeyHGQDPRKNLFMGDT-UHFFFAOYSA-N
XLogP3.91
TPSA56.51 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.32
LogP ≤ 53.91
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'cumarine', 'substructure': 'N/A'}

Analyze (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-fluorobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-fluorobenzoate?
The IUPAC name of (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-fluorobenzoate (CID 7864171) is (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-fluorobenzoate.
What is the SMILES notation for (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-fluorobenzoate?
The canonical SMILES for (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-fluorobenzoate is Cc1cc2oc(=O)cc(COC(=O)c3ccccc3F)c2cc1C.
What is the InChIKey of (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-fluorobenzoate?
The InChIKey is HGQDPRKNLFMGDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15FO4/c1-11-7-15-13(9-18(21)24-17(15)8-12(11)2)10-23-19(22)14-5-3-4-6-16(14)20/h3-9H,10H2,1-2H3.
What are the key properties of (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-fluorobenzoate?
(6,7-dimethyl-2-oxochromen-4-yl)methyl 2-fluorobenzoate has a molecular weight of 326.32 g/mol, XLogP of 3.91, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-fluorobenzoate is sourced from PubChem (CID 7864171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).