C19H15FO4 — CID 7864171
(6,7-dimethyl-2-oxochromen-4-yl)methyl 2-fluorobenzoate (PubChem CID 7864171) has the molecular formula C19H15FO4 and a molecular weight of 326.32 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-fluorobenzoate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-fluorobenzoate |
|---|---|
| PubChem CID | 7864171 |
| Molecular Formula | C19H15FO4 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-fluorobenzoate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)c3ccccc3F)c2cc1C |
| InChI | InChI=1S/C19H15FO4/c1-11-7-15-13(9-18(21)24-17(15)8-12(11)2)10-23-19(22)14-5-3-4-6-16(14)20/h3-9H,10H2,1-2H3 |
| InChIKey | HGQDPRKNLFMGDT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|