C21H16O4S — CID 7490468
(6,7-dimethyl-2-oxochromen-4-yl)methyl 1-benzothiophene-2-carboxylate (PubChem CID 7490468) has the molecular formula C21H16O4S and a molecular weight of 364.42 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl 1-benzothiophene-2-carboxylate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7490468 |
| Molecular Formula | C21H16O4S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 1-benzothiophene-2-carboxylate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)c3cc4ccccc4s3)c2cc1C |
| InChI | InChI=1S/C21H16O4S/c1-12-7-16-15(10-20(22)25-17(16)8-13(12)2)11-24-21(23)19-9-14-5-3-4-6-18(14)26-19/h3-10H,11H2,1-2H3 |
| InChIKey | QPFZXEMRLWOGJQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|