C22H17NO4S — CID 55326197
(6,7-dimethyl-2-oxochromen-4-yl)methyl (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate (PubChem CID 55326197) has the molecular formula C22H17NO4S and a molecular weight of 391.45 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 55326197 |
| Molecular Formula | C22H17NO4S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)/C=C/c3nc4ccccc4s3)c2cc1C |
| InChI | InChI=1S/C22H17NO4S/c1-13-9-16-15(11-22(25)27-18(16)10-14(13)2)12-26-21(24)8-7-20-23-17-5-3-4-6-19(17)28-20/h3-11H,12H2,1-2H3/b8-7+ |
| InChIKey | DFVIVXHJNBKVOT-BQYQJAHWSA-N |
| XLogP | 4.78 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|