C17H11N3O3S2 — CID 8738802
(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate (PubChem CID 8738802) has the molecular formula C17H11N3O3S2 and a molecular weight of 369.43 g/mol. Its IUPAC name is (3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate.
| Compound Name | (3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8738802 |
| Molecular Formula | C17H11N3O3S2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | (3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1nc2ccccc2s1)OCc1nc(-c2ccsc2)no1 |
| InChI | InChI=1S/C17H11N3O3S2/c21-16(6-5-15-18-12-3-1-2-4-13(12)25-15)22-9-14-19-17(20-23-14)11-7-8-24-10-11/h1-8,10H,9H2/b6-5+ |
| InChIKey | DUBNGGYSASYHGM-AATRIKPKSA-N |
| XLogP | 4.16 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|