C14H9IN2O3S — CID 26735067
(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl 4-iodobenzoate (PubChem CID 26735067) has the molecular formula C14H9IN2O3S and a molecular weight of 412.21 g/mol. Its IUPAC name is (3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl 4-iodobenzoate.
| Compound Name | (3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl 4-iodobenzoate |
|---|---|
| PubChem CID | 26735067 |
| Molecular Formula | C14H9IN2O3S |
| Molecular Weight | 412.21 g/mol |
| Exact Mass | 411.94 |
| IUPAC Name | (3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl 4-iodobenzoate |
| SMILES | O=C(OCc1nc(-c2ccsc2)no1)c1ccc(I)cc1 |
| InChI | InChI=1S/C14H9IN2O3S/c15-11-3-1-9(2-4-11)14(18)19-7-12-16-13(17-20-12)10-5-6-21-8-10/h1-6,8H,7H2 |
| InChIKey | YCHOXLKFFACFRD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.21 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|