C14H8Cl2N2O3S — CID 26764804
(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl 3,5-dichlorobenzoate (PubChem CID 26764804) has the molecular formula C14H8Cl2N2O3S and a molecular weight of 355.20 g/mol. Its IUPAC name is (3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl 3,5-dichlorobenzoate.
| Compound Name | (3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl 3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 26764804 |
| Molecular Formula | C14H8Cl2N2O3S |
| Molecular Weight | 355.20 g/mol |
| Exact Mass | 353.96 |
| IUPAC Name | (3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl 3,5-dichlorobenzoate |
| SMILES | O=C(OCc1nc(-c2ccsc2)no1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H8Cl2N2O3S/c15-10-3-9(4-11(16)5-10)14(19)20-6-12-17-13(18-21-12)8-1-2-22-7-8/h1-5,7H,6H2 |
| InChIKey | LYCYYCJIUBAGAD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.20 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |