C16H11ClN2O4 — CID 9412685
[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl 4-hydroxybenzoate (PubChem CID 9412685) has the molecular formula C16H11ClN2O4 and a molecular weight of 330.73 g/mol. Its IUPAC name is [3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl 4-hydroxybenzoate.
| Compound Name | [3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl 4-hydroxybenzoate |
|---|---|
| PubChem CID | 9412685 |
| Molecular Formula | C16H11ClN2O4 |
| Molecular Weight | 330.73 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | [3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl 4-hydroxybenzoate |
| SMILES | O=C(OCc1nc(-c2cccc(Cl)c2)no1)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H11ClN2O4/c17-12-3-1-2-11(8-12)15-18-14(23-19-15)9-22-16(21)10-4-6-13(20)7-5-10/h1-8,20H,9H2 |
| InChIKey | BEYWWJWIEZSVFN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.73 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |