C13H11N3O4S — CID 3978990
[2-(carbamoylamino)-2-oxoethyl] 3-(1,3-benzothiazol-2-yl)prop-2-enoate (PubChem CID 3978990) has the molecular formula C13H11N3O4S and a molecular weight of 305.32 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] 3-(1,3-benzothiazol-2-yl)prop-2-enoate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] 3-(1,3-benzothiazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 3978990 |
| Molecular Formula | C13H11N3O4S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] 3-(1,3-benzothiazol-2-yl)prop-2-enoate |
| SMILES | NC(=O)NC(=O)COC(=O)C=Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H11N3O4S/c14-13(19)16-10(17)7-20-12(18)6-5-11-15-8-3-1-2-4-9(8)21-11/h1-6H,7H2,(H3,14,16,17,19) |
| InChIKey | QQIYZDRYHQWXDX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|