C18H11F3N2O3S — CID 7907629
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate (PubChem CID 7907629) has the molecular formula C18H11F3N2O3S and a molecular weight of 392.36 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7907629 |
| Molecular Formula | C18H11F3N2O3S |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1nc2ccccc2s1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H11F3N2O3S/c19-10-5-6-12(18(21)17(10)20)22-14(24)9-26-16(25)8-7-15-23-11-3-1-2-4-13(11)27-15/h1-8H,9H2,(H,22,24)/b8-7+ |
| InChIKey | OSWAISNHWXQEBJ-BQYQJAHWSA-N |
| XLogP | 3.91 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|