C20H17ClN2O3S — CID 42903738
[2-[1-(4-chlorophenyl)ethylamino]-2-oxoethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate (PubChem CID 42903738) has the molecular formula C20H17ClN2O3S and a molecular weight of 400.89 g/mol. Its IUPAC name is [2-[1-(4-chlorophenyl)ethylamino]-2-oxoethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate.
| Compound Name | [2-[1-(4-chlorophenyl)ethylamino]-2-oxoethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 42903738 |
| Molecular Formula | C20H17ClN2O3S |
| Molecular Weight | 400.89 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | [2-[1-(4-chlorophenyl)ethylamino]-2-oxoethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
| SMILES | CC(NC(=O)COC(=O)/C=C/c1nc2ccccc2s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H17ClN2O3S/c1-13(14-6-8-15(21)9-7-14)22-18(24)12-26-20(25)11-10-19-23-16-4-2-3-5-17(16)27-19/h2-11,13H,12H2,1H3,(H,22,24)/b11-10+ |
| InChIKey | RHEYMLPKEQNHBY-ZHACJKMWSA-N |
| XLogP | 4.38 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.89 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|