(6,7-dimethyl-2-oxochromen-4-yl)methyl 2-phenylbenzoate

C25H20O4 — CID 7229157

IUPAC(6,7-dimethyl-2-oxochromen-4-yl)methyl 2-phenylbenzoate
SMILESCc1cc2oc(=O)cc(COC(=O)c3ccccc3-c3ccccc3)c2cc1C
InChIInChI=1S/C25H20O4/c1-16-12-22-19(14-24(26)29-23(22)13-17(16)2)15-28-25(27)21-11-7-6-10-20(21)18-8-4-3-5-9-18/h3-14H,15H2,1-2H3
InChIKeyLWAAPTZLJDEVCF-UHFFFAOYSA-N
MW384.43 g/mol
LogP5.43
Rot. Bonds4

About (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-phenylbenzoate

(6,7-dimethyl-2-oxochromen-4-yl)methyl 2-phenylbenzoate (PubChem CID 7229157) has the molecular formula C25H20O4 and a molecular weight of 384.43 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-phenylbenzoate.

Molecular Properties

Compound Name(6,7-dimethyl-2-oxochromen-4-yl)methyl 2-phenylbenzoate
PubChem CID7229157
Molecular FormulaC25H20O4
Molecular Weight384.43 g/mol
Exact Mass384.14
IUPAC Name(6,7-dimethyl-2-oxochromen-4-yl)methyl 2-phenylbenzoate
SMILESCc1cc2oc(=O)cc(COC(=O)c3ccccc3-c3ccccc3)c2cc1C
InChIInChI=1S/C25H20O4/c1-16-12-22-19(14-24(26)29-23(22)13-17(16)2)15-28-25(27)21-11-7-6-10-20(21)18-8-4-3-5-9-18/h3-14H,15H2,1-2H3
InChIKeyLWAAPTZLJDEVCF-UHFFFAOYSA-N
XLogP5.43
TPSA56.51 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms29
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500384.43
LogP ≤ 55.43
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'cumarine', 'substructure': 'N/A'}

Analyze (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-phenylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-phenylbenzoate?
The IUPAC name of (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-phenylbenzoate (CID 7229157) is (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-phenylbenzoate.
What is the SMILES notation for (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-phenylbenzoate?
The canonical SMILES for (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-phenylbenzoate is Cc1cc2oc(=O)cc(COC(=O)c3ccccc3-c3ccccc3)c2cc1C.
What is the InChIKey of (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-phenylbenzoate?
The InChIKey is LWAAPTZLJDEVCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20O4/c1-16-12-22-19(14-24(26)29-23(22)13-17(16)2)15-28-25(27)21-11-7-6-10-20(21)18-8-4-3-5-9-18/h3-14H,15H2,1-2H3.
What are the key properties of (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-phenylbenzoate?
(6,7-dimethyl-2-oxochromen-4-yl)methyl 2-phenylbenzoate has a molecular weight of 384.43 g/mol, XLogP of 5.43, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-phenylbenzoate is sourced from PubChem (CID 7229157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).