C27H24O4 — CID 7795348
(6,7-dimethyl-2-oxochromen-4-yl)methyl 3,3-diphenylpropanoate (PubChem CID 7795348) has the molecular formula C27H24O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl 3,3-diphenylpropanoate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 7795348 |
| Molecular Formula | C27H24O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 3,3-diphenylpropanoate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)CC(c3ccccc3)c3ccccc3)c2cc1C |
| InChI | InChI=1S/C27H24O4/c1-18-13-24-22(15-27(29)31-25(24)14-19(18)2)17-30-26(28)16-23(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-15,23H,16-17H2,1-2H3 |
| InChIKey | SMUIYXKQFUGLPP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|