C24H18O5S — CID 46812034
(6,7-dimethyl-2-oxochromen-4-yl)methyl 2-(thiophene-2-carbonyl)benzoate (PubChem CID 46812034) has the molecular formula C24H18O5S and a molecular weight of 418.47 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-(thiophene-2-carbonyl)benzoate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-(thiophene-2-carbonyl)benzoate |
|---|---|
| PubChem CID | 46812034 |
| Molecular Formula | C24H18O5S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-(thiophene-2-carbonyl)benzoate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)c3ccccc3C(=O)c3cccs3)c2cc1C |
| InChI | InChI=1S/C24H18O5S/c1-14-10-19-16(12-22(25)29-20(19)11-15(14)2)13-28-24(27)18-7-4-3-6-17(18)23(26)21-8-5-9-30-21/h3-12H,13H2,1-2H3 |
| InChIKey | NRWIGBXCJLEVFW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|