C21H17F3O4 — CID 8013797
(6,7-dimethyl-2-oxochromen-4-yl)methyl 2-[3-(trifluoromethyl)phenyl]acetate (PubChem CID 8013797) has the molecular formula C21H17F3O4 and a molecular weight of 390.36 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-[3-(trifluoromethyl)phenyl]acetate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-[3-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 8013797 |
| Molecular Formula | C21H17F3O4 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-[3-(trifluoromethyl)phenyl]acetate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)Cc3cccc(C(F)(F)F)c3)c2cc1C |
| InChI | InChI=1S/C21H17F3O4/c1-12-6-17-15(10-20(26)28-18(17)7-13(12)2)11-27-19(25)9-14-4-3-5-16(8-14)21(22,23)24/h3-8,10H,9,11H2,1-2H3 |
| InChIKey | GAKDLZTXWSNELJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|