C24H21F3O4 — CID 3455660
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 3455660) has the molecular formula C24H21F3O4 and a molecular weight of 430.42 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 3455660 |
| Molecular Formula | C24H21F3O4 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)C=Cc3cccc(C(F)(F)F)c3)c2cc1C(C)C |
| InChI | InChI=1S/C24H21F3O4/c1-14(2)19-12-20-17(11-23(29)31-21(20)9-15(19)3)13-30-22(28)8-7-16-5-4-6-18(10-16)24(25,26)27/h4-12,14H,13H2,1-3H3 |
| InChIKey | BPTIDWOGNWLMJD-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|