C21H18Cl2O4 — CID 5026475
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3,4-dichlorobenzoate (PubChem CID 5026475) has the molecular formula C21H18Cl2O4 and a molecular weight of 405.28 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3,4-dichlorobenzoate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 5026475 |
| Molecular Formula | C21H18Cl2O4 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3,4-dichlorobenzoate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)c3ccc(Cl)c(Cl)c3)c2cc1C(C)C |
| InChI | InChI=1S/C21H18Cl2O4/c1-11(2)15-9-16-14(8-20(24)27-19(16)6-12(15)3)10-26-21(25)13-4-5-17(22)18(23)7-13/h4-9,11H,10H2,1-3H3 |
| InChIKey | BXTTZKUSPSSLDY-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|