C19H19NO4S — CID 55769065
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 55769065) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 55769065 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)c3scnc3C)c2cc1C(C)C |
| InChI | InChI=1S/C19H19NO4S/c1-10(2)14-7-15-13(6-17(21)24-16(15)5-11(14)3)8-23-19(22)18-12(4)20-9-25-18/h5-7,9-10H,8H2,1-4H3 |
| InChIKey | QDVKCNUYWQBPHI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|