C23H23ClO5 — CID 3488878
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(4-chloro-2-methylphenoxy)acetate (PubChem CID 3488878) has the molecular formula C23H23ClO5 and a molecular weight of 414.89 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(4-chloro-2-methylphenoxy)acetate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(4-chloro-2-methylphenoxy)acetate |
|---|---|
| PubChem CID | 3488878 |
| Molecular Formula | C23H23ClO5 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(4-chloro-2-methylphenoxy)acetate |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)OCc1cc(=O)oc2cc(C)c(C(C)C)cc12 |
| InChI | InChI=1S/C23H23ClO5/c1-13(2)18-10-19-16(9-22(25)29-21(19)8-14(18)3)11-28-23(26)12-27-20-6-5-17(24)7-15(20)4/h5-10,13H,11-12H2,1-4H3 |
| InChIKey | KDGUJNOUXXBZHB-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|