C23H24O4 — CID 4611377
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3,5-dimethylbenzoate (PubChem CID 4611377) has the molecular formula C23H24O4 and a molecular weight of 364.44 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3,5-dimethylbenzoate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 4611377 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3,5-dimethylbenzoate |
| SMILES | Cc1cc(C)cc(C(=O)OCc2cc(=O)oc3cc(C)c(C(C)C)cc23)c1 |
| InChI | InChI=1S/C23H24O4/c1-13(2)19-11-20-18(10-22(24)27-21(20)9-16(19)5)12-26-23(25)17-7-14(3)6-15(4)8-17/h6-11,13H,12H2,1-5H3 |
| InChIKey | RWHMSRALSYCDHP-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|