C22H19F3O5 — CID 4043070
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 4-(trifluoromethoxy)benzoate (PubChem CID 4043070) has the molecular formula C22H19F3O5 and a molecular weight of 420.38 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 4-(trifluoromethoxy)benzoate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 4-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 4043070 |
| Molecular Formula | C22H19F3O5 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 4-(trifluoromethoxy)benzoate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)c3ccc(OC(F)(F)F)cc3)c2cc1C(C)C |
| InChI | InChI=1S/C22H19F3O5/c1-12(2)17-10-18-15(9-20(26)29-19(18)8-13(17)3)11-28-21(27)14-4-6-16(7-5-14)30-22(23,24)25/h4-10,12H,11H2,1-3H3 |
| InChIKey | MBWIDBJPDKPOKZ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|