C22H20ClFO4 — CID 7718271
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(2-chloro-6-fluorophenyl)acetate (PubChem CID 7718271) has the molecular formula C22H20ClFO4 and a molecular weight of 402.85 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(2-chloro-6-fluorophenyl)acetate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(2-chloro-6-fluorophenyl)acetate |
|---|---|
| PubChem CID | 7718271 |
| Molecular Formula | C22H20ClFO4 |
| Molecular Weight | 402.85 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(2-chloro-6-fluorophenyl)acetate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)Cc3c(F)cccc3Cl)c2cc1C(C)C |
| InChI | InChI=1S/C22H20ClFO4/c1-12(2)15-9-16-14(8-22(26)28-20(16)7-13(15)3)11-27-21(25)10-17-18(23)5-4-6-19(17)24/h4-9,12H,10-11H2,1-3H3 |
| InChIKey | XYLVGBMMAWNPRD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.85 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|