C25H26O7 — CID 4996054
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(4-acetyl-2-methoxyphenoxy)acetate (PubChem CID 4996054) has the molecular formula C25H26O7 and a molecular weight of 438.48 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(4-acetyl-2-methoxyphenoxy)acetate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(4-acetyl-2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 4996054 |
| Molecular Formula | C25H26O7 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(4-acetyl-2-methoxyphenoxy)acetate |
| SMILES | COc1cc(C(C)=O)ccc1OCC(=O)OCc1cc(=O)oc2cc(C)c(C(C)C)cc12 |
| InChI | InChI=1S/C25H26O7/c1-14(2)19-11-20-18(10-24(27)32-22(20)8-15(19)3)12-31-25(28)13-30-21-7-6-17(16(4)26)9-23(21)29-5/h6-11,14H,12-13H2,1-5H3 |
| InChIKey | IELNQDFTFCSOIE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|