C22H20O7 — CID 7753487
(6,7-dimethyl-2-oxochromen-4-yl)methyl 2-(4-formyl-2-methoxyphenoxy)acetate (PubChem CID 7753487) has the molecular formula C22H20O7 and a molecular weight of 396.40 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-(4-formyl-2-methoxyphenoxy)acetate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-(4-formyl-2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 7753487 |
| Molecular Formula | C22H20O7 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-(4-formyl-2-methoxyphenoxy)acetate |
| SMILES | COc1cc(C=O)ccc1OCC(=O)OCc1cc(=O)oc2cc(C)c(C)cc12 |
| InChI | InChI=1S/C22H20O7/c1-13-6-17-16(9-21(24)29-19(17)7-14(13)2)11-28-22(25)12-27-18-5-4-15(10-23)8-20(18)26-3/h4-10H,11-12H2,1-3H3 |
| InChIKey | JTKFQORMRVHNGE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|